C23H27N3O8 — CID 54196556
2-[2-(carboxymethoxy)-5-methoxyphenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]acetic acid (PubChem CID 54196556) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-5-methoxyphenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-5-methoxyphenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 54196556 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[2-(carboxymethoxy)-5-methoxyphenyl]-2-[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]anilino]acetic acid |
| SMILES | COc1ccc(OCC(=O)O)c(C(Nc2ccc(C=NNC(=O)OC(C)(C)C)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C23H27N3O8/c1-23(2,3)34-22(31)26-24-12-14-5-7-15(8-6-14)25-20(21(29)30)17-11-16(32-4)9-10-18(17)33-13-19(27)28/h5-12,20,25H,13H2,1-4H3,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | PMFIYUWCVGJZEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 155.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|