C20H23N3O7 — CID 172983483
3-[2-[carboxy-[4-[(Z)-(hydroxyhydrazinylidene)methyl]anilino]methyl]-4,5-dimethoxyphenyl]propanoic acid (PubChem CID 172983483) has the molecular formula C20H23N3O7 and a molecular weight of 417.42 g/mol. Its IUPAC name is 3-[2-[carboxy-[4-[(Z)-(hydroxyhydrazinylidene)methyl]anilino]methyl]-4,5-dimethoxyphenyl]propanoic acid.
| Compound Name | 3-[2-[carboxy-[4-[(Z)-(hydroxyhydrazinylidene)methyl]anilino]methyl]-4,5-dimethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 172983483 |
| Molecular Formula | C20H23N3O7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-[2-[carboxy-[4-[(Z)-(hydroxyhydrazinylidene)methyl]anilino]methyl]-4,5-dimethoxyphenyl]propanoic acid |
| SMILES | COc1cc(CCC(=O)O)c(C(Nc2ccc(/C=N\NO)cc2)C(=O)O)cc1OC |
| InChI | InChI=1S/C20H23N3O7/c1-29-16-9-13(5-8-18(24)25)15(10-17(16)30-2)19(20(26)27)22-14-6-3-12(4-7-14)11-21-23-28/h3-4,6-7,9-11,19,22-23,28H,5,8H2,1-2H3,(H,24,25)(H,26,27)/b21-11- |
| InChIKey | DCURZKAUZBRHLU-NHDPSOOVSA-N |
| XLogP | 2.27 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|