C22H26N2O3S — CID 54006477
2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)butanoic acid (PubChem CID 54006477) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)butanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 54006477 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)butanoic acid |
| SMILES | CCSc1cc(C(CC)(Nc2ccc(C#N)cc2)C(=O)O)ccc1OC(C)C |
| InChI | InChI=1S/C22H26N2O3S/c1-5-22(21(25)26,24-18-10-7-16(14-23)8-11-18)17-9-12-19(27-15(3)4)20(13-17)28-6-2/h7-13,15,24H,5-6H2,1-4H3,(H,25,26) |
| InChIKey | KPFPMLDTFMDFQM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |