C26H27N3O2 — CID 91403826
2-(4-cyanoanilino)-2-[3-[4-(dimethylamino)phenyl]-5-methylphenyl]butanoic acid (PubChem CID 91403826) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[3-[4-(dimethylamino)phenyl]-5-methylphenyl]butanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[3-[4-(dimethylamino)phenyl]-5-methylphenyl]butanoic acid |
|---|---|
| PubChem CID | 91403826 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[3-[4-(dimethylamino)phenyl]-5-methylphenyl]butanoic acid |
| SMILES | CCC(Nc1ccc(C#N)cc1)(C(=O)O)c1cc(C)cc(-c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-5-26(25(30)31,28-23-10-6-19(17-27)7-11-23)22-15-18(2)14-21(16-22)20-8-12-24(13-9-20)29(3)4/h6-16,28H,5H2,1-4H3,(H,30,31) |
| InChIKey | NLNPXPVTQDZZOG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |