C27H32N2O6S — CID 54046907
N-hydroxy-7-[3-[4-methoxy-3-(2-pyridin-2-ylethoxy)phenyl]sulfonylphenyl]heptanamide (PubChem CID 54046907) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is N-hydroxy-7-[3-[4-methoxy-3-(2-pyridin-2-ylethoxy)phenyl]sulfonylphenyl]heptanamide.
| Compound Name | N-hydroxy-7-[3-[4-methoxy-3-(2-pyridin-2-ylethoxy)phenyl]sulfonylphenyl]heptanamide |
|---|---|
| PubChem CID | 54046907 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-hydroxy-7-[3-[4-methoxy-3-(2-pyridin-2-ylethoxy)phenyl]sulfonylphenyl]heptanamide |
| SMILES | COc1ccc(S(=O)(=O)c2cccc(CCCCCCC(=O)NO)c2)cc1OCCc1ccccn1 |
| InChI | InChI=1S/C27H32N2O6S/c1-34-25-15-14-24(20-26(25)35-18-16-22-11-6-7-17-28-22)36(32,33)23-12-8-10-21(19-23)9-4-2-3-5-13-27(30)29-31/h6-8,10-12,14-15,17,19-20,31H,2-5,9,13,16,18H2,1H3,(H,29,30) |
| InChIKey | LQFCICYONVDBEG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|