C15H21F3N4O2 — CID 54055633
ethyl 2-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methylamino]acetate (PubChem CID 54055633) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is ethyl 2-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methylamino]acetate.
| Compound Name | ethyl 2-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methylamino]acetate |
|---|---|
| PubChem CID | 54055633 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl 2-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methylamino]acetate |
| SMILES | CCOC(=O)CNCC1CCN(c2ccnc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C15H21F3N4O2/c1-2-24-13(23)10-19-9-11-4-7-22(8-5-11)12-3-6-20-14(21-12)15(16,17)18/h3,6,11,19H,2,4-5,7-10H2,1H3 |
| InChIKey | LWAXFARNNXHNHS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |