C22H24N2O5 — CID 54056159
2-methoxyimino-N-methylidene-2-[2-[[2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)phenoxy]methyl]phenyl]acetamide (PubChem CID 54056159) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-methoxyimino-N-methylidene-2-[2-[[2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)phenoxy]methyl]phenyl]acetamide.
| Compound Name | 2-methoxyimino-N-methylidene-2-[2-[[2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)phenoxy]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54056159 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-methoxyimino-N-methylidene-2-[2-[[2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)phenoxy]methyl]phenyl]acetamide |
| SMILES | C=NC(=O)C(=NOC)c1ccccc1COc1ccc(C2(C)OCCO2)cc1C |
| InChI | InChI=1S/C22H24N2O5/c1-15-13-17(22(2)28-11-12-29-22)9-10-19(15)27-14-16-7-5-6-8-18(16)20(24-26-4)21(25)23-3/h5-10,13H,3,11-12,14H2,1-2,4H3 |
| InChIKey | LWKBQRYWTBBZKZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|