C31H44N6O4 — CID 54061833
[4-[4-(7-methoxy-7-oxoheptyl)piperazin-1-yl]-2,6-dipyrrolidin-1-ylpyrimidin-5-yl] benzoate (PubChem CID 54061833) has the molecular formula C31H44N6O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is [4-[4-(7-methoxy-7-oxoheptyl)piperazin-1-yl]-2,6-dipyrrolidin-1-ylpyrimidin-5-yl] benzoate.
| Compound Name | [4-[4-(7-methoxy-7-oxoheptyl)piperazin-1-yl]-2,6-dipyrrolidin-1-ylpyrimidin-5-yl] benzoate |
|---|---|
| PubChem CID | 54061833 |
| Molecular Formula | C31H44N6O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | [4-[4-(7-methoxy-7-oxoheptyl)piperazin-1-yl]-2,6-dipyrrolidin-1-ylpyrimidin-5-yl] benzoate |
| SMILES | COC(=O)CCCCCCN1CCN(c2nc(N3CCCC3)nc(N3CCCC3)c2OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H44N6O4/c1-40-26(38)15-7-2-3-8-16-34-21-23-36(24-22-34)29-27(41-30(39)25-13-5-4-6-14-25)28(35-17-9-10-18-35)32-31(33-29)37-19-11-12-20-37/h4-6,13-14H,2-3,7-12,15-24H2,1H3 |
| InChIKey | MAGMMDIBTVPMCB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|