C23H29ClN6O2 — CID 67922259
(4-piperazin-1-yl-2,6-dipyrrolidin-1-ylpyrimidin-5-yl) 4-chlorobenzoate (PubChem CID 67922259) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is (4-piperazin-1-yl-2,6-dipyrrolidin-1-ylpyrimidin-5-yl) 4-chlorobenzoate.
| Compound Name | (4-piperazin-1-yl-2,6-dipyrrolidin-1-ylpyrimidin-5-yl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 67922259 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (4-piperazin-1-yl-2,6-dipyrrolidin-1-ylpyrimidin-5-yl) 4-chlorobenzoate |
| SMILES | O=C(Oc1c(N2CCCC2)nc(N2CCCC2)nc1N1CCNCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN6O2/c24-18-7-5-17(6-8-18)22(31)32-19-20(28-11-1-2-12-28)26-23(30-13-3-4-14-30)27-21(19)29-15-9-25-10-16-29/h5-8,25H,1-4,9-16H2 |
| InChIKey | PFGFYMWNFFZBHE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |