C22H17F5O2 — CID 54072329
5-[4-[(4-ethylphenyl)-hydroperoxymethyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 54072329) has the molecular formula C22H17F5O2 and a molecular weight of 408.37 g/mol. Its IUPAC name is 5-[4-[(4-ethylphenyl)-hydroperoxymethyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-[4-[(4-ethylphenyl)-hydroperoxymethyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54072329 |
| Molecular Formula | C22H17F5O2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-[4-[(4-ethylphenyl)-hydroperoxymethyl]phenyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | CCc1ccc(C(OO)c2ccc(-c3cc(F)c(C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C22H17F5O2/c1-2-13-3-5-15(6-4-13)21(29-28)16-9-7-14(8-10-16)17-11-18(23)20(19(24)12-17)22(25,26)27/h3-12,21,28H,2H2,1H3 |
| InChIKey | MHHWRBSEBMORFG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|