C23H36N4O2S — CID 54073711
tert-butyl 4-[4-[(1-ethylpiperidin-4-yl)carbamothioyl]phenyl]piperazine-1-carboxylate (PubChem CID 54073711) has the molecular formula C23H36N4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is tert-butyl 4-[4-[(1-ethylpiperidin-4-yl)carbamothioyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(1-ethylpiperidin-4-yl)carbamothioyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54073711 |
| Molecular Formula | C23H36N4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | tert-butyl 4-[4-[(1-ethylpiperidin-4-yl)carbamothioyl]phenyl]piperazine-1-carboxylate |
| SMILES | CCN1CCC(NC(=S)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H36N4O2S/c1-5-25-12-10-19(11-13-25)24-21(30)18-6-8-20(9-7-18)26-14-16-27(17-15-26)22(28)29-23(2,3)4/h6-9,19H,5,10-17H2,1-4H3,(H,24,30) |
| InChIKey | MIGFULUHDNGODM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|