C26H24N4O — CID 54078156
N-[1-[5-(2,3-dihydroindol-1-yliminomethyl)-1-benzofuran-2-yl]ethylideneamino]-N-methylaniline (PubChem CID 54078156) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[1-[5-(2,3-dihydroindol-1-yliminomethyl)-1-benzofuran-2-yl]ethylideneamino]-N-methylaniline.
| Compound Name | N-[1-[5-(2,3-dihydroindol-1-yliminomethyl)-1-benzofuran-2-yl]ethylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 54078156 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[1-[5-(2,3-dihydroindol-1-yliminomethyl)-1-benzofuran-2-yl]ethylideneamino]-N-methylaniline |
| SMILES | CC(=NN(C)c1ccccc1)c1cc2cc(C=NN3CCc4ccccc43)ccc2o1 |
| InChI | InChI=1S/C26H24N4O/c1-19(28-29(2)23-9-4-3-5-10-23)26-17-22-16-20(12-13-25(22)31-26)18-27-30-15-14-21-8-6-7-11-24(21)30/h3-13,16-18H,14-15H2,1-2H3 |
| InChIKey | MLDYDHLARMNVJT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|