C24H25NO2 — CID 54079414
N-[4-[2-(8-hydroxynaphthalen-2-yl)ethenyl]phenyl]-2,2-dimethylbutanamide (PubChem CID 54079414) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[4-[2-(8-hydroxynaphthalen-2-yl)ethenyl]phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-[2-(8-hydroxynaphthalen-2-yl)ethenyl]phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 54079414 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-[4-[2-(8-hydroxynaphthalen-2-yl)ethenyl]phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(C=Cc2ccc3cccc(O)c3c2)cc1 |
| InChI | InChI=1S/C24H25NO2/c1-4-24(2,3)23(27)25-20-14-11-17(12-15-20)8-9-18-10-13-19-6-5-7-22(26)21(19)16-18/h5-16,26H,4H2,1-3H3,(H,25,27) |
| InChIKey | MLZZATSLIYMEHV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|