C31H52N2O3 — CID 54080612
N-(4-amino-4-oxobutyl)-4-hexyl-N-phenylmethoxytetradec-5-enamide (PubChem CID 54080612) has the molecular formula C31H52N2O3 and a molecular weight of 500.77 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-hexyl-N-phenylmethoxytetradec-5-enamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-hexyl-N-phenylmethoxytetradec-5-enamide |
|---|---|
| PubChem CID | 54080612 |
| Molecular Formula | C31H52N2O3 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-hexyl-N-phenylmethoxytetradec-5-enamide |
| SMILES | CCCCCCCCC=CC(CCCCCC)CCC(=O)N(CCCC(N)=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H52N2O3/c1-3-5-7-9-10-11-12-15-20-28(19-14-8-6-4-2)24-25-31(35)33(26-18-23-30(32)34)36-27-29-21-16-13-17-22-29/h13,15-17,20-22,28H,3-12,14,18-19,23-27H2,1-2H3,(H2,32,34) |
| InChIKey | MMVKFBJFUWTXBE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|