C20H24O4 — CID 54080745
[4-(hydroxymethyl)phenyl]-[3-(methoxymethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]methanol (PubChem CID 54080745) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]-[3-(methoxymethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]methanol.
| Compound Name | [4-(hydroxymethyl)phenyl]-[3-(methoxymethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 54080745 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]-[3-(methoxymethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]methanol |
| SMILES | COCOc1cc2c(cc1C(O)c1ccc(CO)cc1)CCCC2 |
| InChI | InChI=1S/C20H24O4/c1-23-13-24-19-11-17-5-3-2-4-16(17)10-18(19)20(22)15-8-6-14(12-21)7-9-15/h6-11,20-22H,2-5,12-13H2,1H3 |
| InChIKey | MMXXHNYQXPSRRM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|