(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate

C24H25FN2O2 — CID 54081686

IUPAC(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate
SMILESCCCCc1ccc(OC(=O)c2ccc(-c3cnc(CCC)cn3)cc2)c(F)c1
InChIInChI=1S/C24H25FN2O2/c1-3-5-7-17-8-13-23(21(25)14-17)29-24(28)19-11-9-18(10-12-19)22-16-26-20(6-4-2)15-27-22/h8-16H,3-7H2,1-2H3
InChIKeyMNOOBHABVNCVTD-UHFFFAOYSA-N
MW392.47 g/mol
LogP5.80
Rot. Bonds8

About (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate

(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate (PubChem CID 54081686) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate.

Molecular Properties

Compound Name(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate
PubChem CID54081686
Molecular FormulaC24H25FN2O2
Molecular Weight392.47 g/mol
Exact Mass392.19
IUPAC Name(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate
SMILESCCCCc1ccc(OC(=O)c2ccc(-c3cnc(CCC)cn3)cc2)c(F)c1
InChIInChI=1S/C24H25FN2O2/c1-3-5-7-17-8-13-23(21(25)14-17)29-24(28)19-11-9-18(10-12-19)22-16-26-20(6-4-2)15-27-22/h8-16H,3-7H2,1-2H3
InChIKeyMNOOBHABVNCVTD-UHFFFAOYSA-N
XLogP5.80
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500392.47
LogP ≤ 55.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate?
The IUPAC name of (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate (CID 54081686) is (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate.
What is the SMILES notation for (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate?
The canonical SMILES for (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate is CCCCc1ccc(OC(=O)c2ccc(-c3cnc(CCC)cn3)cc2)c(F)c1.
What is the InChIKey of (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate?
The InChIKey is MNOOBHABVNCVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25FN2O2/c1-3-5-7-17-8-13-23(21(25)14-17)29-24(28)19-11-9-18(10-12-19)22-16-26-20(6-4-2)15-27-22/h8-16H,3-7H2,1-2H3.
What are the key properties of (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate?
(4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate has a molecular weight of 392.47 g/mol, XLogP of 5.80, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butyl-2-fluorophenyl) 4-(5-propylpyrazin-2-yl)benzoate is sourced from PubChem (CID 54081686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).