C19H18FNO2S — CID 54081931
9-(3-acetyl-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 54081931) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is 9-(3-acetyl-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(3-acetyl-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 54081931 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 9-(3-acetyl-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | CC(=O)c1cc(C2C3=C(CCCC3=O)N=C3CCSC32)ccc1F |
| InChI | InChI=1S/C19H18FNO2S/c1-10(22)12-9-11(5-6-13(12)20)17-18-14(3-2-4-16(18)23)21-15-7-8-24-19(15)17/h5-6,9,17,19H,2-4,7-8H2,1H3 |
| InChIKey | MNSXKSIUXFNSPH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |