C16H14BrFN2OS — CID 91521264
9-(3-bromo-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b][1,7]naphthyridin-8-one (PubChem CID 91521264) has the molecular formula C16H14BrFN2OS and a molecular weight of 381.27 g/mol. Its IUPAC name is 9-(3-bromo-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b][1,7]naphthyridin-8-one.
| Compound Name | 9-(3-bromo-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b][1,7]naphthyridin-8-one |
|---|---|
| PubChem CID | 91521264 |
| Molecular Formula | C16H14BrFN2OS |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 9-(3-bromo-4-fluorophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b][1,7]naphthyridin-8-one |
| SMILES | O=C1CNCC2=C1C(c1ccc(F)c(Br)c1)C1SCCC1=N2 |
| InChI | InChI=1S/C16H14BrFN2OS/c17-9-5-8(1-2-10(9)18)14-15-12(6-19-7-13(15)21)20-11-3-4-22-16(11)14/h1-2,5,14,16,19H,3-4,6-7H2 |
| InChIKey | CXUHIKQLWIOKOQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |