C17H15BrN2O3S — CID 57094624
9-(4-bromo-3-nitrophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 57094624) has the molecular formula C17H15BrN2O3S and a molecular weight of 407.29 g/mol. Its IUPAC name is 9-(4-bromo-3-nitrophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(4-bromo-3-nitrophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 57094624 |
| Molecular Formula | C17H15BrN2O3S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 9-(4-bromo-3-nitrophenyl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1ccc(Br)c([N+](=O)[O-])c1)C1SCCC1=N2 |
| InChI | InChI=1S/C17H15BrN2O3S/c18-10-5-4-9(8-13(10)20(22)23)15-16-11(2-1-3-14(16)21)19-12-6-7-24-17(12)15/h4-5,8,15,17H,1-3,6-7H2 |
| InChIKey | AFJVOHNITWLTSB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|