C17H16BrFN2OS — CID 90766230
10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,10,10a-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one (PubChem CID 90766230) has the molecular formula C17H16BrFN2OS and a molecular weight of 395.30 g/mol. Its IUPAC name is 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,10,10a-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one.
| Compound Name | 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,10,10a-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one |
|---|---|
| PubChem CID | 90766230 |
| Molecular Formula | C17H16BrFN2OS |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,10,10a-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one |
| SMILES | O=C1CNCC2=C1C(c1ccc(F)c(Br)c1)C1SCCCC1=N2 |
| InChI | InChI=1S/C17H16BrFN2OS/c18-10-6-9(3-4-11(10)19)15-16-13(7-20-8-14(16)22)21-12-2-1-5-23-17(12)15/h3-4,6,15,17,20H,1-2,5,7-8H2 |
| InChIKey | AEZKKFUAOWAFKG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |