C17H14BrFN2O2S — CID 18000940
5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydrothiopyrano[3,4-b][1,7]naphthyridine-4,6-dione (PubChem CID 18000940) has the molecular formula C17H14BrFN2O2S and a molecular weight of 409.28 g/mol. Its IUPAC name is 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydrothiopyrano[3,4-b][1,7]naphthyridine-4,6-dione.
| Compound Name | 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydrothiopyrano[3,4-b][1,7]naphthyridine-4,6-dione |
|---|---|
| PubChem CID | 18000940 |
| Molecular Formula | C17H14BrFN2O2S |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydrothiopyrano[3,4-b][1,7]naphthyridine-4,6-dione |
| SMILES | O=C1CNCC2=C1C(c1ccc(F)c(Br)c1)C1=C(CSCC1=O)N2 |
| InChI | InChI=1S/C17H14BrFN2O2S/c18-9-3-8(1-2-10(9)19)15-16-11(4-20-5-13(16)22)21-12-6-24-7-14(23)17(12)15/h1-3,15,20-21H,4-7H2 |
| InChIKey | YMHXARJHKGJEKS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |