C17H14Br2N2O3 — CID 10115075
5-(3,4-dibromophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione (PubChem CID 10115075) has the molecular formula C17H14Br2N2O3 and a molecular weight of 454.12 g/mol. Its IUPAC name is 5-(3,4-dibromophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione.
| Compound Name | 5-(3,4-dibromophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione |
|---|---|
| PubChem CID | 10115075 |
| Molecular Formula | C17H14Br2N2O3 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | 5-(3,4-dibromophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione |
| SMILES | O=C1CNCC2=C1C(c1ccc(Br)c(Br)c1)C1=C(COCC1=O)N2 |
| InChI | InChI=1S/C17H14Br2N2O3/c18-9-2-1-8(3-10(9)19)15-16-11(4-20-5-13(16)22)21-12-6-24-7-14(23)17(12)15/h1-3,15,20-21H,4-7H2 |
| InChIKey | VDSFKXYVBXEYEE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |