C17H17BrClFN2O3S — CID 18000983
10-(3-bromo-4-fluorophenyl)-1,1-dioxo-2,3,4,5,6,7,8,10-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one;hydrochloride (PubChem CID 18000983) has the molecular formula C17H17BrClFN2O3S and a molecular weight of 463.76 g/mol. Its IUPAC name is 10-(3-bromo-4-fluorophenyl)-1,1-dioxo-2,3,4,5,6,7,8,10-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one;hydrochloride.
| Compound Name | 10-(3-bromo-4-fluorophenyl)-1,1-dioxo-2,3,4,5,6,7,8,10-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one;hydrochloride |
|---|---|
| PubChem CID | 18000983 |
| Molecular Formula | C17H17BrClFN2O3S |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | 10-(3-bromo-4-fluorophenyl)-1,1-dioxo-2,3,4,5,6,7,8,10-octahydrothiopyrano[3,2-b][1,7]naphthyridin-9-one;hydrochloride |
| SMILES | Cl.O=C1CNCC2=C1C(c1ccc(F)c(Br)c1)C1=C(CCCS1(=O)=O)N2 |
| InChI | InChI=1S/C17H16BrFN2O3S.ClH/c18-10-6-9(3-4-11(10)19)15-16-13(7-20-8-14(16)22)21-12-2-1-5-25(23,24)17(12)15;/h3-4,6,15,20-21H,1-2,5,7-8H2;1H |
| InChIKey | XFGOCRGRCNYCEK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |