C17H15N3O3S2 — CID 11211016
(9S)-9-(2,1,3-benzothiadiazol-5-yl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 11211016) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (9S)-9-(2,1,3-benzothiadiazol-5-yl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | (9S)-9-(2,1,3-benzothiadiazol-5-yl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 11211016 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (9S)-9-(2,1,3-benzothiadiazol-5-yl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1[C@H](c1ccc3nsnc3c1)C1=C(CCS1(=O)=O)N2 |
| InChI | InChI=1S/C17H15N3O3S2/c21-14-3-1-2-11-16(14)15(17-12(18-11)6-7-25(17,22)23)9-4-5-10-13(8-9)20-24-19-10/h4-5,8,15,18H,1-3,6-7H2/t15-/m0/s1 |
| InChIKey | GIQURAIMHWBKJH-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |