C17H16BrNO3S — CID 11486225
9-(3-bromophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 11486225) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is 9-(3-bromophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(3-bromophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 11486225 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 9-(3-bromophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1cccc(Br)c1)C1=C(CCS1(=O)=O)N2 |
| InChI | InChI=1S/C17H16BrNO3S/c18-11-4-1-3-10(9-11)15-16-12(5-2-6-14(16)20)19-13-7-8-23(21,22)17(13)15/h1,3-4,9,15,19H,2,5-8H2 |
| InChIKey | STHBSLDIMWHCJC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |