C17H15BrFN3O2 — CID 91159188
10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,9a,10-octahydropyrido[3,4-b][1,6]naphthyridine-1,9-dione (PubChem CID 91159188) has the molecular formula C17H15BrFN3O2 and a molecular weight of 392.23 g/mol. Its IUPAC name is 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,9a,10-octahydropyrido[3,4-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,9a,10-octahydropyrido[3,4-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 91159188 |
| Molecular Formula | C17H15BrFN3O2 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 10-(3-bromo-4-fluorophenyl)-2,3,4,6,7,8,9a,10-octahydropyrido[3,4-b][1,6]naphthyridine-1,9-dione |
| SMILES | O=C1NCCC2=C1C(c1ccc(F)c(Br)c1)C1C(=O)CNCC1=N2 |
| InChI | InChI=1S/C17H15BrFN3O2/c18-9-5-8(1-2-10(9)19)14-15-12(6-20-7-13(15)23)22-11-3-4-21-17(24)16(11)14/h1-2,5,14-15,20H,3-4,6-7H2,(H,21,24) |
| InChIKey | DRPLKZYPORSZMQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |