C20H19BrFNO2S — CID 57039057
5-(3-bromo-4-fluorophenyl)-7,7-dimethyl-5,5a,8,9-tetrahydro-1H-thiopyrano[3,4-b]quinoline-4,6-dione (PubChem CID 57039057) has the molecular formula C20H19BrFNO2S and a molecular weight of 436.35 g/mol. Its IUPAC name is 5-(3-bromo-4-fluorophenyl)-7,7-dimethyl-5,5a,8,9-tetrahydro-1H-thiopyrano[3,4-b]quinoline-4,6-dione.
| Compound Name | 5-(3-bromo-4-fluorophenyl)-7,7-dimethyl-5,5a,8,9-tetrahydro-1H-thiopyrano[3,4-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 57039057 |
| Molecular Formula | C20H19BrFNO2S |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 5-(3-bromo-4-fluorophenyl)-7,7-dimethyl-5,5a,8,9-tetrahydro-1H-thiopyrano[3,4-b]quinoline-4,6-dione |
| SMILES | CC1(C)CCC2=NC3=C(C(=O)CSC3)C(c3ccc(F)c(Br)c3)C2C1=O |
| InChI | InChI=1S/C20H19BrFNO2S/c1-20(2)6-5-13-18(19(20)25)16(10-3-4-12(22)11(21)7-10)17-14(23-13)8-26-9-15(17)24/h3-4,7,16,18H,5-6,8-9H2,1-2H3 |
| InChIKey | MSCRXOAEMVXYPL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |