C17H15N3O2S — CID 91023090
(9R)-9-(2,1,3-benzoxadiazol-5-yl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 91023090) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is (9R)-9-(2,1,3-benzoxadiazol-5-yl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | (9R)-9-(2,1,3-benzoxadiazol-5-yl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 91023090 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (9R)-9-(2,1,3-benzoxadiazol-5-yl)-3,5,6,7,9,9a-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc3nonc3c1)C1SCCC1=N2 |
| InChI | InChI=1S/C17H15N3O2S/c21-14-3-1-2-11-16(14)15(17-12(18-11)6-7-23-17)9-4-5-10-13(8-9)20-22-19-10/h4-5,8,15,17H,1-3,6-7H2/t15-,17?/m1/s1 |
| InChIKey | VGDSRROPOBZTLZ-LDCVWXEPSA-N |
| XLogP | 3.27 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |