C23H17NO4 — CID 6550069
(10R,10aS)-10-(1,3-benzodioxol-5-yl)-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 6550069) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is (10R,10aS)-10-(1,3-benzodioxol-5-yl)-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10R,10aS)-10-(1,3-benzodioxol-5-yl)-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 6550069 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (10R,10aS)-10-(1,3-benzodioxol-5-yl)-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc3c(c1)OCO3)[C@@H]1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C23H17NO4/c25-16-7-3-6-15-20(16)19(12-8-9-17-18(10-12)28-11-27-17)21-22(24-15)13-4-1-2-5-14(13)23(21)26/h1-2,4-5,8-10,19,21H,3,6-7,11H2/t19-,21+/m1/s1 |
| InChIKey | UTFDOICSYNMKMM-CTNGQTDRSA-N |
| XLogP | 3.82 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|