C19H19N3O6S — CID 90790581
9-(2-hydroxy-3,5-dinitrophenyl)-7,7-dimethyl-2,3,5,6,9,9a-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 90790581) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is 9-(2-hydroxy-3,5-dinitrophenyl)-7,7-dimethyl-2,3,5,6,9,9a-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(2-hydroxy-3,5-dinitrophenyl)-7,7-dimethyl-2,3,5,6,9,9a-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 90790581 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 9-(2-hydroxy-3,5-dinitrophenyl)-7,7-dimethyl-2,3,5,6,9,9a-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)C1SCCC1=N2 |
| InChI | InChI=1S/C19H19N3O6S/c1-19(2)5-3-11-15(18(19)24)14(17-12(20-11)4-6-29-17)10-7-9(21(25)26)8-13(16(10)23)22(27)28/h7-8,14,17,23H,3-6H2,1-2H3 |
| InChIKey | FYBMDNGERDPNLL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|