C19H19BrN2O4S — CID 70149453
9-(3-bromo-2-hydroxy-5-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 70149453) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is 9-(3-bromo-2-hydroxy-5-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(3-bromo-2-hydroxy-5-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 70149453 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 9-(3-bromo-2-hydroxy-5-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1cc([N+](=O)[O-])cc(Br)c1O)C1=C(CCS1)N2 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-19(2)5-3-12-15(18(19)24)14(17-13(21-12)4-6-27-17)10-7-9(22(25)26)8-11(20)16(10)23/h7-8,14,21,23H,3-6H2,1-2H3 |
| InChIKey | CFZNZZAKNRNWHF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|