C19H19ClN2O3S — CID 70148979
9-(4-chloro-3-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 70148979) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 9-(4-chloro-3-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(4-chloro-3-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 70148979 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 9-(4-chloro-3-nitrophenyl)-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1ccc(Cl)c([N+](=O)[O-])c1)C1=C(CCS1)N2 |
| InChI | InChI=1S/C19H19ClN2O3S/c1-19(2)7-5-12-16(18(19)23)15(17-13(21-12)6-8-26-17)10-3-4-11(20)14(9-10)22(24)25/h3-4,9,15,21H,5-8H2,1-2H3 |
| InChIKey | QFENIKRTNYGNJA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|