C28H34N2O7 — CID 54082819
1-[(2S)-2-(2,2-dimethylpropanoyloxy)-6-(phenylmethoxycarbonylamino)hexanoyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 54082819) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is 1-[(2S)-2-(2,2-dimethylpropanoyloxy)-6-(phenylmethoxycarbonylamino)hexanoyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-[(2S)-2-(2,2-dimethylpropanoyloxy)-6-(phenylmethoxycarbonylamino)hexanoyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 54082819 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-[(2S)-2-(2,2-dimethylpropanoyloxy)-6-(phenylmethoxycarbonylamino)hexanoyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC(C)(C)C(=O)O[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)N1c2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C28H34N2O7/c1-28(2,3)26(34)37-23(15-9-10-16-29-27(35)36-18-19-11-5-4-6-12-19)24(31)30-21-14-8-7-13-20(21)17-22(30)25(32)33/h4-8,11-14,22-23H,9-10,15-18H2,1-3H3,(H,29,35)(H,32,33)/t22?,23-/m0/s1 |
| InChIKey | MOHWBMGEXVTOSK-WCSIJFPASA-N |
| XLogP | 4.08 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|