C30H38N4O6 — CID 110193109
methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[[(2S)-1-(piperidine-4-carbonyl)-2,3-dihydroindole-2-carbonyl]amino]hexanoate (PubChem CID 110193109) has the molecular formula C30H38N4O6 and a molecular weight of 550.66 g/mol. Its IUPAC name is methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[[(2S)-1-(piperidine-4-carbonyl)-2,3-dihydroindole-2-carbonyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[[(2S)-1-(piperidine-4-carbonyl)-2,3-dihydroindole-2-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 110193109 |
| Molecular Formula | C30H38N4O6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[[(2S)-1-(piperidine-4-carbonyl)-2,3-dihydroindole-2-carbonyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@@H]1Cc2ccccc2N1C(=O)C1CCNCC1 |
| InChI | InChI=1S/C30H38N4O6/c1-39-29(37)24(12-7-8-16-32-30(38)40-20-21-9-3-2-4-10-21)33-27(35)26-19-23-11-5-6-13-25(23)34(26)28(36)22-14-17-31-18-15-22/h2-6,9-11,13,22,24,26,31H,7-8,12,14-20H2,1H3,(H,32,38)(H,33,35)/t24-,26-/m0/s1 |
| InChIKey | RYXDHBWJZCAKNT-AHWVRZQESA-N |
| XLogP | 2.70 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|