C6H14N2O3 — CID 54083369
1,3-diethoxy-1-methylurea (PubChem CID 54083369) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 1,3-diethoxy-1-methylurea.
| Compound Name | 1,3-diethoxy-1-methylurea |
|---|---|
| PubChem CID | 54083369 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1,3-diethoxy-1-methylurea |
| SMILES | CCONC(=O)N(C)OCC |
| InChI | InChI=1S/C6H14N2O3/c1-4-10-7-6(9)8(3)11-5-2/h4-5H2,1-3H3,(H,7,9) |
| InChIKey | MORVUBQIWURQLA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|