C25H20O4 — CID 54083882
methyl 4-[4-oxo-3-(2-phenylmethoxyphenyl)buta-1,3-dienyl]benzoate (PubChem CID 54083882) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 4-[4-oxo-3-(2-phenylmethoxyphenyl)buta-1,3-dienyl]benzoate.
| Compound Name | methyl 4-[4-oxo-3-(2-phenylmethoxyphenyl)buta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 54083882 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl 4-[4-oxo-3-(2-phenylmethoxyphenyl)buta-1,3-dienyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=C=O)c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20O4/c1-28-25(27)21-14-11-19(12-15-21)13-16-22(17-26)23-9-5-6-10-24(23)29-18-20-7-3-2-4-8-20/h2-16H,18H2,1H3 |
| InChIKey | MPANCOWNYZOEFC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|