C28H38O8 — CID 54085150
[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] 4-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 54085150) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] 4-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] 4-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 54085150 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] 4-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | C=CC(C)=CC=C(C(C)=CC(=O)O[C@H]1[C@H](O)[C@@H](O)[C@@H](OC)O[C@@H]1CO)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C28H38O8/c1-9-15(2)10-11-20(24-17(4)12-21(33-7)18(5)19(24)6)16(3)13-23(30)36-27-22(14-29)35-28(34-8)26(32)25(27)31/h9-13,22,25-29,31-32H,1,14H2,2-8H3/t22-,25-,26-,27-,28+/m1/s1 |
| InChIKey | MPXVDPWQOJNMHI-FJUXYKJISA-N |
| XLogP | 3.08 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|