C2H6Br2O7P2 — CID 54093847
(2,2-dibromo-1-hydroxy-1-phosphonoethyl)phosphonic acid (PubChem CID 54093847) has the molecular formula C2H6Br2O7P2 and a molecular weight of 363.82 g/mol. Its IUPAC name is (2,2-dibromo-1-hydroxy-1-phosphonoethyl)phosphonic acid.
| Compound Name | (2,2-dibromo-1-hydroxy-1-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 54093847 |
| Molecular Formula | C2H6Br2O7P2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 361.80 |
| IUPAC Name | (2,2-dibromo-1-hydroxy-1-phosphonoethyl)phosphonic acid |
| SMILES | O=P(O)(O)C(O)(C(Br)Br)P(=O)(O)O |
| InChI | InChI=1S/C2H6Br2O7P2/c3-1(4)2(5,12(6,7)8)13(9,10)11/h1,5H,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | MVSJUKBTUWYGQU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|