C5H15NO7P2Se — CID 174996759
(2-amino-1-hydroxy-4-methylselanyl-1-phosphonobutyl)phosphonic acid (PubChem CID 174996759) has the molecular formula C5H15NO7P2Se and a molecular weight of 342.08 g/mol. Its IUPAC name is (2-amino-1-hydroxy-4-methylselanyl-1-phosphonobutyl)phosphonic acid.
| Compound Name | (2-amino-1-hydroxy-4-methylselanyl-1-phosphonobutyl)phosphonic acid |
|---|---|
| PubChem CID | 174996759 |
| Molecular Formula | C5H15NO7P2Se |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | (2-amino-1-hydroxy-4-methylselanyl-1-phosphonobutyl)phosphonic acid |
| SMILES | C[Se]CCC(N)C(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H15NO7P2Se/c1-16-3-2-4(6)5(7,14(8,9)10)15(11,12)13/h4,7H,2-3,6H2,1H3,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | JJRNMWHBVBFQLV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|