C6H16N2O7P2 — CID 154186922
(2-amino-1-hydroxy-4-imino-3-methyl-1-phosphonopentyl)phosphonic acid (PubChem CID 154186922) has the molecular formula C6H16N2O7P2 and a molecular weight of 290.15 g/mol. Its IUPAC name is (2-amino-1-hydroxy-4-imino-3-methyl-1-phosphonopentyl)phosphonic acid.
| Compound Name | (2-amino-1-hydroxy-4-imino-3-methyl-1-phosphonopentyl)phosphonic acid |
|---|---|
| PubChem CID | 154186922 |
| Molecular Formula | C6H16N2O7P2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (2-amino-1-hydroxy-4-imino-3-methyl-1-phosphonopentyl)phosphonic acid |
| SMILES | [H]/N=C(\C)C(C)C(N)C(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H16N2O7P2/c1-3(4(2)7)5(8)6(9,16(10,11)12)17(13,14)15/h3,5,7,9H,8H2,1-2H3,(H2,10,11,12)(H2,13,14,15)/b7-4+ |
| InChIKey | STRSOGNZTNWCDT-QPJJXVBHSA-N |
| XLogP | -1.01 |
| TPSA | 185.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|