C7H18N2O7P2 — CID 57238811
(6-amino-1-hydroxy-5-imino-1-phosphonoheptyl)phosphonic acid (PubChem CID 57238811) has the molecular formula C7H18N2O7P2 and a molecular weight of 304.18 g/mol. Its IUPAC name is (6-amino-1-hydroxy-5-imino-1-phosphonoheptyl)phosphonic acid.
| Compound Name | (6-amino-1-hydroxy-5-imino-1-phosphonoheptyl)phosphonic acid |
|---|---|
| PubChem CID | 57238811 |
| Molecular Formula | C7H18N2O7P2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (6-amino-1-hydroxy-5-imino-1-phosphonoheptyl)phosphonic acid |
| SMILES | [H]/N=C(/CCCC(O)(P(=O)(O)O)P(=O)(O)O)C(C)N |
| InChI | InChI=1S/C7H18N2O7P2/c1-5(8)6(9)3-2-4-7(10,17(11,12)13)18(14,15)16/h5,9-10H,2-4,8H2,1H3,(H2,11,12,13)(H2,14,15,16)/b9-6- |
| InChIKey | MDBHKEYEGVDMLW-TWGQIWQCSA-N |
| XLogP | -0.47 |
| TPSA | 185.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|