C21H27N7O — CID 54094614
2-[7-methyl-2,4-di(piperazin-1-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenol (PubChem CID 54094614) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-[7-methyl-2,4-di(piperazin-1-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenol.
| Compound Name | 2-[7-methyl-2,4-di(piperazin-1-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 54094614 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[7-methyl-2,4-di(piperazin-1-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenol |
| SMILES | Cn1c(-c2ccccc2O)cc2c(N3CCNCC3)nc(N3CCNCC3)nc21 |
| InChI | InChI=1S/C21H27N7O/c1-26-17(15-4-2-3-5-18(15)29)14-16-19(26)24-21(28-12-8-23-9-13-28)25-20(16)27-10-6-22-7-11-27/h2-5,14,22-23,29H,6-13H2,1H3 |
| InChIKey | MWGAMYHFTBHHBK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |