C21H25N5O4S — CID 142646130
[4-(7-methyl-2,4-dipyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-6-yl)phenyl] hydrogen sulfate (PubChem CID 142646130) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is [4-(7-methyl-2,4-dipyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-6-yl)phenyl] hydrogen sulfate.
| Compound Name | [4-(7-methyl-2,4-dipyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-6-yl)phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 142646130 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [4-(7-methyl-2,4-dipyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-6-yl)phenyl] hydrogen sulfate |
| SMILES | Cn1c(-c2ccc(OS(=O)(=O)O)cc2)cc2c(N3CCCC3)nc(N3CCCC3)nc21 |
| InChI | InChI=1S/C21H25N5O4S/c1-24-18(15-6-8-16(9-7-15)30-31(27,28)29)14-17-19(24)22-21(26-12-4-5-13-26)23-20(17)25-10-2-3-11-25/h6-9,14H,2-5,10-13H2,1H3,(H,27,28,29) |
| InChIKey | GQEDRPVCDYQMEO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|