C5H16N4 — CID 54100618
N',N'-diaminopentane-1,5-diamine (PubChem CID 54100618) has the molecular formula C5H16N4 and a molecular weight of 132.21 g/mol. Its IUPAC name is N',N'-diaminopentane-1,5-diamine.
| Compound Name | N',N'-diaminopentane-1,5-diamine |
|---|---|
| PubChem CID | 54100618 |
| Molecular Formula | C5H16N4 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | N',N'-diaminopentane-1,5-diamine |
| SMILES | NCCCCCN(N)N |
| InChI | InChI=1S/C5H16N4/c6-4-2-1-3-5-9(7)8/h1-8H2 |
| InChIKey | NAGNSLJRYVAHDH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|