C7H10NO3S2+ — CID 54102666
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) propanedithioate (PubChem CID 54102666) has the molecular formula C7H10NO3S2+ and a molecular weight of 220.29 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) propanedithioate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) propanedithioate |
|---|---|
| PubChem CID | 54102666 |
| Molecular Formula | C7H10NO3S2+ |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) propanedithioate |
| SMILES | CCC(=S)S[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C7H10NO3S2/c1-2-7(12)13-8(11)5(9)3-4-6(8)10/h11H,2-4H2,1H3/q+1 |
| InChIKey | BQEVKRJVDQRHRX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|