C9H14O — CID 54102876
3,4,4a,7,8,8a-hexahydro-2H-chromene (PubChem CID 54102876) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 3,4,4a,7,8,8a-hexahydro-2H-chromene.
| Compound Name | 3,4,4a,7,8,8a-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 54102876 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 3,4,4a,7,8,8a-hexahydro-2H-chromene |
| SMILES | C1=CC2CCCOC2CC1 |
| InChI | InChI=1S/C9H14O/c1-2-6-9-8(4-1)5-3-7-10-9/h1,4,8-9H,2-3,5-7H2 |
| InChIKey | NBTAJNKUHSVUBZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|