C18H21N3O4 — CID 54105226
3-[2,4-bis(butanoylamino)phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 54105226) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[2,4-bis(butanoylamino)phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[2,4-bis(butanoylamino)phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 54105226 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[2,4-bis(butanoylamino)phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCC(=O)Nc1ccc(C=C(C#N)C(=O)O)c(NC(=O)CCC)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-3-5-16(22)20-14-8-7-12(9-13(11-19)18(24)25)15(10-14)21-17(23)6-4-2/h7-10H,3-6H2,1-2H3,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | NDGSECDQDVJABW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|