C15H18N2O2S2 — CID 54105241
N-(1,3-benzothiazol-2-yl)-2-ethylsulfanyl-2-methyl-3-oxopentanamide (PubChem CID 54105241) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-ethylsulfanyl-2-methyl-3-oxopentanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-ethylsulfanyl-2-methyl-3-oxopentanamide |
|---|---|
| PubChem CID | 54105241 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-ethylsulfanyl-2-methyl-3-oxopentanamide |
| SMILES | CCSC(C)(C(=O)CC)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-4-12(18)15(3,20-5-2)13(19)17-14-16-10-8-6-7-9-11(10)21-14/h6-9H,4-5H2,1-3H3,(H,16,17,19) |
| InChIKey | NDGZAHHSAZEGFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|