C23H22F3NO5 — CID 54110681
2-[1-(1-phenylethyl)-3-[[3-(trifluoromethyl)phenoxy]methyl]azetidin-2-yl]but-2-enedioic acid (PubChem CID 54110681) has the molecular formula C23H22F3NO5 and a molecular weight of 449.43 g/mol. Its IUPAC name is 2-[1-(1-phenylethyl)-3-[[3-(trifluoromethyl)phenoxy]methyl]azetidin-2-yl]but-2-enedioic acid.
| Compound Name | 2-[1-(1-phenylethyl)-3-[[3-(trifluoromethyl)phenoxy]methyl]azetidin-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 54110681 |
| Molecular Formula | C23H22F3NO5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[1-(1-phenylethyl)-3-[[3-(trifluoromethyl)phenoxy]methyl]azetidin-2-yl]but-2-enedioic acid |
| SMILES | CC(c1ccccc1)N1CC(COc2cccc(C(F)(F)F)c2)C1C(=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H22F3NO5/c1-14(15-6-3-2-4-7-15)27-12-16(21(27)19(22(30)31)11-20(28)29)13-32-18-9-5-8-17(10-18)23(24,25)26/h2-11,14,16,21H,12-13H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | NGWHTJWIWNMPEL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|