C15H17NO5 — CID 67905250
(E)-2-[3-hydroxy-1-(1-phenylethyl)azetidin-2-yl]but-2-enedioic acid (PubChem CID 67905250) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (E)-2-[3-hydroxy-1-(1-phenylethyl)azetidin-2-yl]but-2-enedioic acid.
| Compound Name | (E)-2-[3-hydroxy-1-(1-phenylethyl)azetidin-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67905250 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (E)-2-[3-hydroxy-1-(1-phenylethyl)azetidin-2-yl]but-2-enedioic acid |
| SMILES | CC(c1ccccc1)N1CC(O)C1/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H17NO5/c1-9(10-5-3-2-4-6-10)16-8-12(17)14(16)11(15(20)21)7-13(18)19/h2-7,9,12,14,17H,8H2,1H3,(H,18,19)(H,20,21)/b11-7+ |
| InChIKey | UNFFZNUIUAOXBO-YRNVUSSQSA-N |
| XLogP | 0.89 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|